About 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium
1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium (PubChem CID 21029931) has the molecular formula C7H16N2O2S
and a molecular weight of 192.28 g/mol. Its IUPAC name is 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium.
Molecular Properties
| Compound Name | 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium |
| PubChem CID | 21029931 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium |
| SMILES | [CH2-][NH+]1CCCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C7H16N2O2S/c1-8-4-3-5-9(7-6-8)12(2,10)11/h8H,1,3-7H2,2H3 |
| InChIKey | FCZUYMUOFNUZKM-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium?
The IUPAC name of 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium (CID 21029931) is 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium.
What is the SMILES notation for 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium?
The canonical SMILES for 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium is [CH2-][NH+]1CCCN(S(C)(=O)=O)CC1.
What is the InChIKey of 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium?
The InChIKey is FCZUYMUOFNUZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2S/c1-8-4-3-5-9(7-6-8)12(2,10)11/h8H,1,3-7H2,2H3.
What are the key properties of 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium?
1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium has a molecular weight of 192.28 g/mol, XLogP of -1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-4-methylsulfonyl-1,4-diazepan-1-ium is sourced from PubChem (CID 21029931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).