About 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea
1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea (PubChem CID 2102998) has the molecular formula C20H23N3S2
and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea |
| PubChem CID | 2102998 |
| Molecular Formula | C20H23N3S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea |
| SMILES | CCC(C)(C)NC(=S)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C20H23N3S2/c1-5-20(3,4)23-19(24)21-15-9-7-14(8-10-15)18-22-16-11-6-13(2)12-17(16)25-18/h6-12H,5H2,1-4H3,(H2,21,23,24) |
| InChIKey | DNZUJFYJFARAQY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea?
The IUPAC name of 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea (CID 2102998) is 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea.
What is the SMILES notation for 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea?
The canonical SMILES for 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea is CCC(C)(C)NC(=S)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1.
What is the InChIKey of 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea?
The InChIKey is DNZUJFYJFARAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3S2/c1-5-20(3,4)23-19(24)21-15-9-7-14(8-10-15)18-22-16-11-6-13(2)12-17(16)25-18/h6-12H,5H2,1-4H3,(H2,21,23,24).
What are the key properties of 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea?
1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea has a molecular weight of 369.56 g/mol, XLogP of 5.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(2-methylbutan-2-yl)thiourea is sourced from PubChem (CID 2102998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).