C10H9F3N4O2S — CID 21030358
4-methyl-6-methylsulfonyl-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine (PubChem CID 21030358) has the molecular formula C10H9F3N4O2S and a molecular weight of 306.27 g/mol. Its IUPAC name is 4-methyl-6-methylsulfonyl-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine.
| Compound Name | 4-methyl-6-methylsulfonyl-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 21030358 |
| Molecular Formula | C10H9F3N4O2S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-methyl-6-methylsulfonyl-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidine |
| SMILES | Cc1cc(S(C)(=O)=O)nc(-n2ccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C10H9F3N4O2S/c1-6-5-8(20(2,18)19)15-9(14-6)17-4-3-7(16-17)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | ROKJQXSGMDTSSH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |