C21H27N6O9P — CID 21030630
Methyl 2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 21030630) has the molecular formula C21H27N6O9P and a molecular weight of 538.40 g/mol. Its IUPAC name is methyl 2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | Methyl 2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 21030630 |
| Molecular Formula | C21H27N6O9P |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | methyl 2-[[[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(NC(C)C(=O)OC)OC3=CC=C(C=C3)OC)N=[N+]=[N-] |
| InChI | InChI=1S/C21H27N6O9P/c1-12-10-27(21(30)23-19(12)28)18-9-16(24-26-22)17(35-18)11-34-37(31,25-13(2)20(29)33-4)36-15-7-5-14(32-3)6-8-15/h5-8,10,13,16-18H,9,11H2,1-4H3,(H,25,31)(H,23,28,30) |
| InChIKey | BTLBYQQAWSMQOX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | 995 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|