About 4,4-ditert-butylthiane 1,1-dioxide
4,4-ditert-butylthiane 1,1-dioxide (PubChem CID 21030996) has the molecular formula C13H26O2S
and a molecular weight of 246.42 g/mol. Its IUPAC name is 4,4-ditert-butylthiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4,4-ditert-butylthiane 1,1-dioxide |
| PubChem CID | 21030996 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4,4-ditert-butylthiane 1,1-dioxide |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H26O2S/c1-11(2,3)13(12(4,5)6)7-9-16(14,15)10-8-13/h7-10H2,1-6H3 |
| InChIKey | LCZBGJPQSZTFDV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-ditert-butylthiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-ditert-butylthiane 1,1-dioxide?
The IUPAC name of 4,4-ditert-butylthiane 1,1-dioxide (CID 21030996) is 4,4-ditert-butylthiane 1,1-dioxide.
What is the SMILES notation for 4,4-ditert-butylthiane 1,1-dioxide?
The canonical SMILES for 4,4-ditert-butylthiane 1,1-dioxide is CC(C)(C)C1(C(C)(C)C)CCS(=O)(=O)CC1.
What is the InChIKey of 4,4-ditert-butylthiane 1,1-dioxide?
The InChIKey is LCZBGJPQSZTFDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2S/c1-11(2,3)13(12(4,5)6)7-9-16(14,15)10-8-13/h7-10H2,1-6H3.
What are the key properties of 4,4-ditert-butylthiane 1,1-dioxide?
4,4-ditert-butylthiane 1,1-dioxide has a molecular weight of 246.42 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-ditert-butylthiane 1,1-dioxide is sourced from PubChem (CID 21030996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).