C25H19Cl2F3N2O3 — CID 21031196
3-cyano-N-[2-(3,4-dichlorophenyl)-4-oxobutyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide (PubChem CID 21031196) has the molecular formula C25H19Cl2F3N2O3 and a molecular weight of 523.34 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-dichlorophenyl)-4-oxobutyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide.
| Compound Name | 3-cyano-N-[2-(3,4-dichlorophenyl)-4-oxobutyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 21031196 |
| Molecular Formula | C25H19Cl2F3N2O3 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 3-cyano-N-[2-(3,4-dichlorophenyl)-4-oxobutyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide |
| SMILES | COc1c(C#N)cc2ccccc2c1C(=O)N(CC(CC=O)c1ccc(Cl)c(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C25H19Cl2F3N2O3/c1-35-23-18(12-31)10-16-4-2-3-5-19(16)22(23)24(34)32(14-25(28,29)30)13-17(8-9-33)15-6-7-20(26)21(27)11-15/h2-7,9-11,17H,8,13-14H2,1H3 |
| InChIKey | ORQHDMPWUDOFHH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|