C26H21Cl2F3N2O2 — CID 21031197
3-cyano-N-[2-(3,4-dichlorophenyl)pent-4-enyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide (PubChem CID 21031197) has the molecular formula C26H21Cl2F3N2O2 and a molecular weight of 521.37 g/mol. Its IUPAC name is 3-cyano-N-[2-(3,4-dichlorophenyl)pent-4-enyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide.
| Compound Name | 3-cyano-N-[2-(3,4-dichlorophenyl)pent-4-enyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 21031197 |
| Molecular Formula | C26H21Cl2F3N2O2 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 3-cyano-N-[2-(3,4-dichlorophenyl)pent-4-enyl]-2-methoxy-N-(2,2,2-trifluoroethyl)naphthalene-1-carboxamide |
| SMILES | C=CCC(CN(CC(F)(F)F)C(=O)c1c(OC)c(C#N)cc2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2F3N2O2/c1-3-6-18(16-9-10-21(27)22(28)12-16)14-33(15-26(29,30)31)25(34)23-20-8-5-4-7-17(20)11-19(13-32)24(23)35-2/h3-5,7-12,18H,1,6,14-15H2,2H3 |
| InChIKey | LBCJCYFOPRJXKC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|