About ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate
ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate (PubChem CID 21032057) has the molecular formula C16H30N2O3
and a molecular weight of 298.43 g/mol. Its IUPAC name is ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate |
| PubChem CID | 21032057 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-8-21-16(20)12(6)9-13(10(2)3)18(7)15(19)14(17)11(4)5/h9-11,13-14H,8,17H2,1-7H3/b12-9+ |
| InChIKey | GRNPXQVFTPZKBL-FMIVXFBMSA-N |
| XLogP | 1.96 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate?
The IUPAC name of ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate (CID 21032057) is ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate.
What is the SMILES notation for ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate?
The canonical SMILES for ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate is CCOC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(N)C(C)C.
What is the InChIKey of ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate?
The InChIKey is GRNPXQVFTPZKBL-FMIVXFBMSA-N. The full InChI is InChI=1S/C16H30N2O3/c1-8-21-16(20)12(6)9-13(10(2)3)18(7)15(19)14(17)11(4)5/h9-11,13-14H,8,17H2,1-7H3/b12-9+.
What are the key properties of ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate?
ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate has a molecular weight of 298.43 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-[(2-amino-3-methylbutanoyl)-methylamino]-2,5-dimethylhex-2-enoate is sourced from PubChem (CID 21032057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).