C16H24O4 — CID 21032630
ethyl 5-acetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 21032630) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl 5-acetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | ethyl 5-acetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 21032630 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl 5-acetyloxy-6-methyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC=C2C1CCC(C)C2OC(C)=O |
| InChI | InChI=1S/C16H24O4/c1-4-19-16(18)14-7-5-6-13-12(14)9-8-10(2)15(13)20-11(3)17/h6,10,12,14-15H,4-5,7-9H2,1-3H3 |
| InChIKey | FUAWJALLZYCHRS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|