C22H27F3O2 — CID 21032828
(4'aS,4'bR,8'aR,10'aS)-2'-(3,4,5-trifluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene] (PubChem CID 21032828) has the molecular formula C22H27F3O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (4'aS,4'bR,8'aR,10'aS)-2'-(3,4,5-trifluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene].
| Compound Name | (4'aS,4'bR,8'aR,10'aS)-2'-(3,4,5-trifluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene] |
|---|---|
| PubChem CID | 21032828 |
| Molecular Formula | C22H27F3O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (4'aS,4'bR,8'aR,10'aS)-2'-(3,4,5-trifluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene] |
| SMILES | Fc1cc(C2CC[C@H]3[C@@H](CC[C@@H]4CC5(CC[C@H]43)OCCO5)C2)cc(F)c1F |
| InChI | InChI=1S/C22H27F3O2/c23-19-10-16(11-20(24)21(19)25)13-3-4-17-14(9-13)1-2-15-12-22(6-5-18(15)17)26-7-8-27-22/h10-11,13-15,17-18H,1-9,12H2/t13?,14-,15+,17-,18+/m0/s1 |
| InChIKey | JTQMFUFZFNYPKU-LXWIVHRMSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|