C23H33OY+2 — CID 21032917
2-(3,5-dimethylbenzene-4-id-1-yl)-7-methoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;yttrium(3+) (PubChem CID 21032917) has the molecular formula C23H33OY+2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-4-id-1-yl)-7-methoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;yttrium(3+).
| Compound Name | 2-(3,5-dimethylbenzene-4-id-1-yl)-7-methoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;yttrium(3+) |
|---|---|
| PubChem CID | 21032917 |
| Molecular Formula | C23H33OY+2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(3,5-dimethylbenzene-4-id-1-yl)-7-methoxy-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene;yttrium(3+) |
| SMILES | COC1CCC2C(CCC3CC(c4cc(C)[c-]c(C)c4)CCC32)C1.[Y+3] |
| InChI | InChI=1S/C23H33O.Y/c1-15-10-16(2)12-20(11-15)17-6-8-22-18(13-17)4-5-19-14-21(24-3)7-9-23(19)22;/h11-12,17-19,21-23H,4-9,13-14H2,1-3H3;/q-1;+3 |
| InChIKey | WKRLOPNUFBAMDJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|