About 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate
3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate (PubChem CID 21033000) has the molecular formula C9H6NOS2-
and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate.
Molecular Properties
| Compound Name | 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate |
| PubChem CID | 21033000 |
| Molecular Formula | C9H6NOS2- |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate |
| SMILES | [O-]c1cn(-c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C9H7NOS2/c11-8-6-10(9(12)13-8)7-4-2-1-3-5-7/h1-6,11H/p-1 |
| InChIKey | LEGHSJREBQMPAS-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 27.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate?
The IUPAC name of 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate (CID 21033000) is 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate.
What is the SMILES notation for 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate?
The canonical SMILES for 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate is [O-]c1cn(-c2ccccc2)c(=S)s1.
What is the InChIKey of 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate?
The InChIKey is LEGHSJREBQMPAS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NOS2/c11-8-6-10(9(12)13-8)7-4-2-1-3-5-7/h1-6,11H/p-1.
What are the key properties of 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate?
3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate has a molecular weight of 208.29 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-sulfanylidene-1,3-thiazol-5-olate is sourced from PubChem (CID 21033000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).