C19H21F15O2 — CID 21033005
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 21033005) has the molecular formula C19H21F15O2 and a molecular weight of 566.35 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 21033005 |
| Molecular Formula | C19H21F15O2 |
| Molecular Weight | 566.35 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)cyclohexyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C1CCC(C(C)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H21F15O2/c1-4-12(2,15(20,21)22)11(35)36-14(18(29,30)31,19(32,33)34)10-7-5-9(6-8-10)13(3,16(23,24)25)17(26,27)28/h9-10H,4-8H2,1-3H3 |
| InChIKey | IMPREHVZDZELIY-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.35 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |