About 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane
4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane (PubChem CID 21033010) has the molecular formula C10H13F3O
and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane.
Molecular Properties
| Compound Name | 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane |
| PubChem CID | 21033010 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane |
| SMILES | CC1(C(F)(F)F)OC2C3CCC(C3)C21 |
| InChI | InChI=1S/C10H13F3O/c1-9(10(11,12)13)7-5-2-3-6(4-5)8(7)14-9/h5-8H,2-4H2,1H3 |
| InChIKey | SMXYLRZQCPAAQF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane?
The IUPAC name of 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane (CID 21033010) is 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane.
What is the SMILES notation for 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane?
The canonical SMILES for 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane is CC1(C(F)(F)F)OC2C3CCC(C3)C21.
What is the InChIKey of 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane?
The InChIKey is SMXYLRZQCPAAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O/c1-9(10(11,12)13)7-5-2-3-6(4-5)8(7)14-9/h5-8H,2-4H2,1H3.
What are the key properties of 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane?
4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane has a molecular weight of 206.21 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane is sourced from PubChem (CID 21033010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).