C21H24N4O6 — CID 21033093
5-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethoxy]-5-oxopentanoic acid (PubChem CID 21033093) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 5-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethoxy]-5-oxopentanoic acid.
| Compound Name | 5-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 21033093 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 5-[2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethoxy]-5-oxopentanoic acid |
| SMILES | CCN(CCOC(=O)CCCC(=O)O)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H24N4O6/c1-2-24(14-15-31-21(28)5-3-4-20(26)27)18-10-6-16(7-11-18)22-23-17-8-12-19(13-9-17)25(29)30/h6-13H,2-5,14-15H2,1H3,(H,26,27)/b23-22+ |
| InChIKey | FEZMKHKVCSXTJR-GHVJWSGMSA-N |
| XLogP | 4.63 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|