About N-ethylethanamine;propylbenzene;yttrium(3+)
N-ethylethanamine;propylbenzene;yttrium(3+) (PubChem CID 21034054) has the molecular formula C13H20NY
and a molecular weight of 279.22 g/mol. Its IUPAC name is N-ethylethanamine;propylbenzene;yttrium(3+).
Molecular Properties
| Compound Name | N-ethylethanamine;propylbenzene;yttrium(3+) |
| PubChem CID | 21034054 |
| Molecular Formula | C13H20NY |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-ethylethanamine;propylbenzene;yttrium(3+) |
| SMILES | CCCc1[c-]cccc1.[CH2-]CNC[CH2-].[Y+3] |
| InChI | InChI=1S/C9H11.C4H9N.Y/c1-2-6-9-7-4-3-5-8-9;1-3-5-4-2;/h3-5,7H,2,6H2,1H3;5H,1-4H2;/q-1;-2;+3 |
| InChIKey | ZXXKTASXBVNKJD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;propylbenzene;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;propylbenzene;yttrium(3+)?
The IUPAC name of N-ethylethanamine;propylbenzene;yttrium(3+) (CID 21034054) is N-ethylethanamine;propylbenzene;yttrium(3+).
What is the SMILES notation for N-ethylethanamine;propylbenzene;yttrium(3+)?
The canonical SMILES for N-ethylethanamine;propylbenzene;yttrium(3+) is CCCc1[c-]cccc1.[CH2-]CNC[CH2-].[Y+3].
What is the InChIKey of N-ethylethanamine;propylbenzene;yttrium(3+)?
The InChIKey is ZXXKTASXBVNKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11.C4H9N.Y/c1-2-6-9-7-4-3-5-8-9;1-3-5-4-2;/h3-5,7H,2,6H2,1H3;5H,1-4H2;/q-1;-2;+3.
What are the key properties of N-ethylethanamine;propylbenzene;yttrium(3+)?
N-ethylethanamine;propylbenzene;yttrium(3+) has a molecular weight of 279.22 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;propylbenzene;yttrium(3+) is sourced from PubChem (CID 21034054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).