C25H27N5O4 — CID 21034122
(1-benzylpyrrolidin-3-yl) 3-methoxy-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzoate (PubChem CID 21034122) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (1-benzylpyrrolidin-3-yl) 3-methoxy-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzoate.
| Compound Name | (1-benzylpyrrolidin-3-yl) 3-methoxy-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 21034122 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (1-benzylpyrrolidin-3-yl) 3-methoxy-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzoate |
| SMILES | COc1cc(C(=O)OC2CCN(Cc3ccccc3)C2)ccc1NC(=O)Nc1cnc(C)cn1 |
| InChI | InChI=1S/C25H27N5O4/c1-17-13-27-23(14-26-17)29-25(32)28-21-9-8-19(12-22(21)33-2)24(31)34-20-10-11-30(16-20)15-18-6-4-3-5-7-18/h3-9,12-14,20H,10-11,15-16H2,1-2H3,(H2,27,28,29,32) |
| InChIKey | ULLZEFGJRZHIJR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |