About carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+)
carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) (PubChem CID 21034544) has the molecular formula C14H16N2OY+
and a molecular weight of 317.20 g/mol. Its IUPAC name is carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+).
Molecular Properties
| Compound Name | carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) |
| PubChem CID | 21034544 |
| Molecular Formula | C14H16N2OY+ |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) |
| SMILES | Cc1nc(C)c(Oc2cc[c-]cc2)nc1C.[CH3-].[Y+3] |
| InChI | InChI=1S/C13H13N2O.CH3.Y/c1-9-10(2)15-13(11(3)14-9)16-12-7-5-4-6-8-12;;/h5-8H,1-3H3;1H3;/q2*-1;+3 |
| InChIKey | SPFRVNATZCRKOO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+)?
The IUPAC name of carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) (CID 21034544) is carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+).
What is the SMILES notation for carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+)?
The canonical SMILES for carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) is Cc1nc(C)c(Oc2cc[c-]cc2)nc1C.[CH3-].[Y+3].
What is the InChIKey of carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+)?
The InChIKey is SPFRVNATZCRKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N2O.CH3.Y/c1-9-10(2)15-13(11(3)14-9)16-12-7-5-4-6-8-12;;/h5-8H,1-3H3;1H3;/q2*-1;+3.
What are the key properties of carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+)?
carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) has a molecular weight of 317.20 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,3,5-trimethyl-6-(phenoxy)pyrazine;yttrium(3+) is sourced from PubChem (CID 21034544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).