C12H14N4O5S — CID 21034790
methyl 7-(1,3-dioxolan-2-yloxyamino)-5-methylsulfanylpyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 21034790) has the molecular formula C12H14N4O5S and a molecular weight of 326.33 g/mol. Its IUPAC name is methyl 7-(1,3-dioxolan-2-yloxyamino)-5-methylsulfanylpyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-(1,3-dioxolan-2-yloxyamino)-5-methylsulfanylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21034790 |
| Molecular Formula | C12H14N4O5S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | methyl 7-(1,3-dioxolan-2-yloxyamino)-5-methylsulfanylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1c(SC)nc2ccnn2c1NOC1OCCO1 |
| InChI | InChI=1S/C12H14N4O5S/c1-18-11(17)8-9(15-21-12-19-5-6-20-12)16-7(3-4-13-16)14-10(8)22-2/h3-4,12,15H,5-6H2,1-2H3 |
| InChIKey | ZFGRXQWQJKPKJT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|