C25H24N2O6S — CID 21034871
3-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 21034871) has the molecular formula C25H24N2O6S and a molecular weight of 480.54 g/mol. Its IUPAC name is 3-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21034871 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc2c(CN3C(=O)CSC3=O)cnc(C(=O)c3cccc(OC(C)C)c3)c2cc1OC |
| InChI | InChI=1S/C25H24N2O6S/c1-14(2)33-17-7-5-6-15(8-17)24(29)23-19-10-21(32-4)20(31-3)9-18(19)16(11-26-23)12-27-22(28)13-34-25(27)30/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | QQHAHEXFQOHZQU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|