About N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide
N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide (PubChem CID 21034954) has the molecular formula C23H26N2O6S
and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide |
| PubChem CID | 21034954 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide |
| SMILES | COc1cc2c(CNS(C)(=O)=O)cnc(C(=O)c3cccc(OC(C)C)c3)c2cc1OC |
| InChI | InChI=1S/C23H26N2O6S/c1-14(2)31-17-8-6-7-15(9-17)23(26)22-19-11-21(30-4)20(29-3)10-18(19)16(12-24-22)13-25-32(5,27)28/h6-12,14,25H,13H2,1-5H3 |
| InChIKey | VAABJFOYVFQGPJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide (CID 21034954) is N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide is COc1cc2c(CNS(C)(=O)=O)cnc(C(=O)c3cccc(OC(C)C)c3)c2cc1OC.
What is the InChIKey of N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide?
The InChIKey is VAABJFOYVFQGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O6S/c1-14(2)31-17-8-6-7-15(9-17)23(26)22-19-11-21(30-4)20(29-3)10-18(19)16(12-24-22)13-25-32(5,27)28/h6-12,14,25H,13H2,1-5H3.
What are the key properties of N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide?
N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide has a molecular weight of 458.54 g/mol, XLogP of 3.32, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6,7-dimethoxy-1-(3-propan-2-yloxybenzoyl)isoquinolin-4-yl]methyl]methanesulfonamide is sourced from PubChem (CID 21034954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).