About [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate (PubChem CID 2103535) has the molecular formula C16H14F3NO4
and a molecular weight of 341.29 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate |
| PubChem CID | 2103535 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate |
| SMILES | O=C(COC(=O)COc1cccc2ccccc12)NCC(F)(F)F |
| InChI | InChI=1S/C16H14F3NO4/c17-16(18,19)10-20-14(21)8-24-15(22)9-23-13-7-3-5-11-4-1-2-6-12(11)13/h1-7H,8-10H2,(H,20,21) |
| InChIKey | JFUPFMZYVQIFFO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate?
The IUPAC name of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate (CID 2103535) is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate.
What is the SMILES notation for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate?
The canonical SMILES for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate is O=C(COC(=O)COc1cccc2ccccc12)NCC(F)(F)F.
What is the InChIKey of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate?
The InChIKey is JFUPFMZYVQIFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO4/c17-16(18,19)10-20-14(21)8-24-15(22)9-23-13-7-3-5-11-4-1-2-6-12(11)13/h1-7H,8-10H2,(H,20,21).
What are the key properties of [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate?
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate has a molecular weight of 341.29 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-naphthalen-1-yloxyacetate is sourced from PubChem (CID 2103535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).