About CID 21035628
CID 21035628 (PubChem CID 21035628) has the molecular formula C10H19OSi
and a molecular weight of 183.35 g/mol.
Molecular Properties
| Compound Name | CID 21035628 |
| PubChem CID | 21035628 |
| Molecular Formula | C10H19OSi |
| Molecular Weight | 183.35 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCC1CCC2OC2C1 |
| InChI | InChI=1S/C10H19OSi/c1-12(2)6-5-8-3-4-9-10(7-8)11-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | FCZLEASCBHYFLD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 21035628 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21035628?
The IUPAC name of CID 21035628 (CID 21035628) is not available.
What is the SMILES notation for CID 21035628?
The canonical SMILES for CID 21035628 is C[Si](C)CCC1CCC2OC2C1.
What is the InChIKey of CID 21035628?
The InChIKey is FCZLEASCBHYFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19OSi/c1-12(2)6-5-8-3-4-9-10(7-8)11-9/h8-10H,3-7H2,1-2H3.
What are the key properties of CID 21035628?
CID 21035628 has a molecular weight of 183.35 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21035628 is sourced from PubChem (CID 21035628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).