C16H19FO2 — CID 21035797
3-(4-fluorophenyl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one (PubChem CID 21035797) has the molecular formula C16H19FO2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one.
| Compound Name | 3-(4-fluorophenyl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 21035797 |
| Molecular Formula | C16H19FO2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(4-fluorophenyl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyran-1-one |
| SMILES | CC1CCC2C(C)C(c3ccc(F)cc3)OC(=O)C12 |
| InChI | InChI=1S/C16H19FO2/c1-9-3-8-13-10(2)15(19-16(18)14(9)13)11-4-6-12(17)7-5-11/h4-7,9-10,13-15H,3,8H2,1-2H3 |
| InChIKey | YRCITIMTMOHRDV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |