C11H22B2O4 — CID 21036220
4,4,5,5-tetramethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 21036220) has the molecular formula C11H22B2O4 and a molecular weight of 239.92 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 21036220 |
| Molecular Formula | C11H22B2O4 |
| Molecular Weight | 239.92 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C11H22B2O4/c1-8-9(2,3)15-12(14-8)13-16-10(4,5)11(6,7)17-13/h8H,1-7H3 |
| InChIKey | QYEJHBPKFMZFEE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.92 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|