C21H20FNO2S2 — CID 21036352
N-[(4-fluorophenyl)methyl]-4-methylsulfanyl-N-(4-methylsulfonylphenyl)aniline (PubChem CID 21036352) has the molecular formula C21H20FNO2S2 and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-methylsulfanyl-N-(4-methylsulfonylphenyl)aniline.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-methylsulfanyl-N-(4-methylsulfonylphenyl)aniline |
|---|---|
| PubChem CID | 21036352 |
| Molecular Formula | C21H20FNO2S2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-methylsulfanyl-N-(4-methylsulfonylphenyl)aniline |
| SMILES | CSc1ccc(N(Cc2ccc(F)cc2)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H20FNO2S2/c1-26-20-11-7-18(8-12-20)23(15-16-3-5-17(22)6-4-16)19-9-13-21(14-10-19)27(2,24)25/h3-14H,15H2,1-2H3 |
| InChIKey | OADXAJJZHLDOQB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |