C28H44N4O6S — CID 21036412
2-(4-cyclohexylbutanoylamino)-4-methyl-N-[7-methyl-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]pentanamide (PubChem CID 21036412) has the molecular formula C28H44N4O6S and a molecular weight of 564.75 g/mol. Its IUPAC name is 2-(4-cyclohexylbutanoylamino)-4-methyl-N-[7-methyl-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]pentanamide.
| Compound Name | 2-(4-cyclohexylbutanoylamino)-4-methyl-N-[7-methyl-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]pentanamide |
|---|---|
| PubChem CID | 21036412 |
| Molecular Formula | C28H44N4O6S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 2-(4-cyclohexylbutanoylamino)-4-methyl-N-[7-methyl-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]pentanamide |
| SMILES | CC(C)CC(NC(=O)CCCC1CCCCC1)C(=O)NC1CCC(C)N(S(=O)(=O)c2cccc[n+]2[O-])CC1=O |
| InChI | InChI=1S/C28H44N4O6S/c1-20(2)18-24(29-26(34)13-9-12-22-10-5-4-6-11-22)28(35)30-23-16-15-21(3)32(19-25(23)33)39(37,38)27-14-7-8-17-31(27)36/h7-8,14,17,20-24H,4-6,9-13,15-16,18-19H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | DOJNFVDBBWTSGI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|