C16H22N2 — CID 21036483
(11S,16S)-7,10-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4-triene (PubChem CID 21036483) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (11S,16S)-7,10-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4-triene.
| Compound Name | (11S,16S)-7,10-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4-triene |
|---|---|
| PubChem CID | 21036483 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (11S,16S)-7,10-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4-triene |
| SMILES | c1cc2c3c(c1)C[C@@H]1CCCC[C@@H]1N3CCNC2 |
| InChI | InChI=1S/C16H22N2/c1-2-7-15-12(4-1)10-13-5-3-6-14-11-17-8-9-18(15)16(13)14/h3,5-6,12,15,17H,1-2,4,7-11H2/t12-,15-/m0/s1 |
| InChIKey | YHRJYSIYVCTRGG-WFASDCNBSA-N |
| XLogP | 2.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |