About 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide
4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide (PubChem CID 21037245) has the molecular formula C20H15BrN4O2S
and a molecular weight of 455.34 g/mol. Its IUPAC name is 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide |
| PubChem CID | 21037245 |
| Molecular Formula | C20H15BrN4O2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3sc(Nc4ccc(Br)cc4)nc3c2)ccn1 |
| InChI | InChI=1S/C20H15BrN4O2S/c1-22-19(26)17-11-15(8-9-23-17)27-14-6-7-18-16(10-14)25-20(28-18)24-13-4-2-12(21)3-5-13/h2-11H,1H3,(H,22,26)(H,24,25) |
| InChIKey | ZRRFUDDSSHZCBP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide?
The IUPAC name of 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide (CID 21037245) is 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide is CNC(=O)c1cc(Oc2ccc3sc(Nc4ccc(Br)cc4)nc3c2)ccn1.
What is the InChIKey of 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide?
The InChIKey is ZRRFUDDSSHZCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrN4O2S/c1-22-19(26)17-11-15(8-9-23-17)27-14-6-7-18-16(10-14)25-20(28-18)24-13-4-2-12(21)3-5-13/h2-11H,1H3,(H,22,26)(H,24,25).
What are the key properties of 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide?
4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide has a molecular weight of 455.34 g/mol, XLogP of 5.35, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 21037245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).