C17H9Cl2N3O3S — CID 2103772
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 2103772) has the molecular formula C17H9Cl2N3O3S and a molecular weight of 406.25 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 2103772 |
| Molecular Formula | C17H9Cl2N3O3S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2N3O3S/c18-10-7-9(8-20-15(10)19)16(23)22-17-21-13(11-3-1-5-24-11)14(26-17)12-4-2-6-25-12/h1-8H,(H,21,22,23) |
| InChIKey | XMFWNWWCQVLRGF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|