C23H39NO3 — CID 21037903
5-[(3aR,5R,6S,6aR)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 21037903) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 5-[(3aR,5R,6S,6aR)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aR,5R,6S,6aR)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 21037903 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 5-[(3aR,5R,6S,6aR)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CCCCC[C@@H](O)/C=C/[C@H]1[C@@H]2CC(CCCCC(=O)N(C)C)=C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C23H39NO3/c1-4-5-6-10-19(25)12-13-20-21-15-17(14-18(21)16-22(20)26)9-7-8-11-23(27)24(2)3/h12-14,18-22,25-26H,4-11,15-16H2,1-3H3/b13-12+/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | DNPIEXRJWPVHDF-XOMBYXOUSA-N |
| XLogP | 4.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|