C23H41NO2 — CID 21037904
(2R,3S,3aR,6aR)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21037904) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is (2R,3S,3aR,6aR)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aR,6aR)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21037904 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | (2R,3S,3aR,6aR)-5-[5-(dimethylamino)pentyl]-3-[(E,3R)-3-hydroxyoct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC[C@@H](O)/C=C/[C@H]1[C@@H]2CC(CCCCCN(C)C)=C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C23H41NO2/c1-4-5-7-11-20(25)12-13-21-22-16-18(15-19(22)17-23(21)26)10-8-6-9-14-24(2)3/h12-13,15,19-23,25-26H,4-11,14,16-17H2,1-3H3/b13-12+/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | XLRQKRRQOYINMP-YXRSUKCASA-N |
| XLogP | 4.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|