C27H49NO3 — CID 21038019
(2R,3R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038019) has the molecular formula C27H49NO3 and a molecular weight of 435.69 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038019 |
| Molecular Formula | C27H49NO3 |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCOCCN(C)C(C)(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H49NO3/c1-7-8-9-20(2)16-23(29)10-11-24-25-18-21(17-22(25)19-26(24)30)12-14-31-15-13-28(6)27(3,4)5/h10-11,17,20,22-26,29-30H,7-9,12-16,18-19H2,1-6H3/b11-10+/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | DULZTMSOMAYZHQ-CSDCFYRQSA-N |
| XLogP | 5.20 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|