C31H45NO3 — CID 21038052
[3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 21038052) has the molecular formula C31H45NO3 and a molecular weight of 479.71 g/mol. Its IUPAC name is [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 21038052 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCc3cccc(C(=O)N4CCCCC4)c3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C31H45NO3/c1-3-4-15-31(2,35)16-9-12-27-28-21-24(20-26(28)22-29(27)33)14-13-23-10-8-11-25(19-23)30(34)32-17-6-5-7-18-32/h8-12,19-20,26-29,33,35H,3-7,13-18,21-22H2,1-2H3/b12-9+/t26-,27+,28-,29+,31-/m0/s1 |
| InChIKey | DYMROVYDIRLYAW-QBADNDRYSA-N |
| XLogP | 6.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|