C23H39NO4 — CID 21038189
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-dimethylpropanamide (PubChem CID 21038189) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-dimethylpropanamide.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 21038189 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-dimethylpropanamide |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(COCCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H39NO4/c1-5-6-10-23(2,27)11-7-8-19-20-14-17(13-18(20)15-21(19)25)16-28-12-9-22(26)24(3)4/h7-8,13,18-21,25,27H,5-6,9-12,14-16H2,1-4H3/b8-7+/t18-,19+,20-,21+,23-/m0/s1 |
| InChIKey | KUDDHYXWBAHUFR-ORXXMEBTSA-N |
| XLogP | 3.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|