C24H39NO3 — CID 21038263
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 21038263) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 21038263 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCC(=O)N3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H39NO3/c1-2-3-4-9-20(26)11-12-21-22-16-18(15-19(22)17-23(21)27)8-7-10-24(28)25-13-5-6-14-25/h11-12,15,19-23,26-27H,2-10,13-14,16-17H2,1H3/b12-11+/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | CPSRAVKYEHTIJT-DNVPONHRSA-N |
| XLogP | 4.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|