C28H35NO — CID 21038323
(2R,3R,3aS,6aS)-5-[[3-(dimethylamino)phenyl]methyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038323) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[[3-(dimethylamino)phenyl]methyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[[3-(dimethylamino)phenyl]methyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038323 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[[3-(dimethylamino)phenyl]methyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(CC/C=C/[C@@H]2[C@H]3CC(Cc4cccc(N(C)C)c4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C28H35NO/c1-20-8-6-10-21(14-20)9-4-5-13-26-27-18-23(16-24(27)19-28(26)30)15-22-11-7-12-25(17-22)29(2)3/h5-8,10-14,16-17,24,26-28,30H,4,9,15,18-19H2,1-3H3/b13-5+/t24-,26+,27-,28+/m0/s1 |
| InChIKey | DMRFTGOITNEJFX-NDVXTSKBSA-N |
| XLogP | 5.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|