C24H41NO3 — CID 21038339
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylbutanamide (PubChem CID 21038339) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylbutanamide.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 21038339 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylbutanamide |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H41NO3/c1-5-6-8-17(2)13-20(26)11-12-21-22-15-18(14-19(22)16-23(21)27)9-7-10-24(28)25(3)4/h11-12,14,17,19-23,26-27H,5-10,13,15-16H2,1-4H3/b12-11+/t17-,19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | KJAIKNPVEKAZBF-RLVKZKJBSA-N |
| XLogP | 4.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|