C25H41NO3 — CID 21038357
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one (PubChem CID 21038357) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 21038357 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCC(=O)N3CCCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H41NO3/c1-2-3-5-10-21(27)12-13-22-23-17-19(16-20(23)18-24(22)28)9-8-11-25(29)26-14-6-4-7-15-26/h12-13,16,20-24,27-28H,2-11,14-15,17-18H2,1H3/b13-12+/t20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | WKMKQZMLQNAEFO-BJUWCYMWSA-N |
| XLogP | 4.61 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|