C27H45NO3 — CID 21038359
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one (PubChem CID 21038359) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 21038359 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-piperidin-1-ylbutan-1-one |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCC(=O)N3CCCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H45NO3/c1-3-4-9-20(2)16-23(29)12-13-24-25-18-21(17-22(25)19-26(24)30)10-8-11-27(31)28-14-6-5-7-15-28/h12-13,17,20,22-26,29-30H,3-11,14-16,18-19H2,1-2H3/b13-12+/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | PQMYWBCXNNNFTA-SZYCQUGCSA-N |
| XLogP | 5.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|