C28H48N2O3 — CID 21038400
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-(4-methylpiperazin-1-yl)pentan-1-one (PubChem CID 21038400) has the molecular formula C28H48N2O3 and a molecular weight of 460.70 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-(4-methylpiperazin-1-yl)pentan-1-one.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-(4-methylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 21038400 |
| Molecular Formula | C28H48N2O3 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-(4-methylpiperazin-1-yl)pentan-1-one |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)N3CCN(C)CC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C28H48N2O3/c1-4-5-8-21(2)17-24(31)11-12-25-26-19-22(18-23(26)20-27(25)32)9-6-7-10-28(33)30-15-13-29(3)14-16-30/h11-12,18,21,23-27,31-32H,4-10,13-17,19-20H2,1-3H3/b12-11+/t21-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | LZPMQCZNPHCFSF-VSONWBAFSA-N |
| XLogP | 4.40 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|