C25H37NO2 — CID 21038413
(2R,3R,3aS,6aS)-5-[[4-(aminomethyl)phenyl]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038413) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[[4-(aminomethyl)phenyl]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[[4-(aminomethyl)phenyl]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038413 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[[4-(aminomethyl)phenyl]methyl]-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(Cc3ccc(CN)cc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H37NO2/c1-3-4-11-25(2,28)12-5-6-22-23-15-20(14-21(23)16-24(22)27)13-18-7-9-19(17-26)10-8-18/h5-10,14,21-24,27-28H,3-4,11-13,15-17,26H2,1-2H3/b6-5+/t21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | ALOIGHWAYXAGSZ-SUSZJDFMSA-N |
| XLogP | 4.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|