C26H43NO5 — CID 21038454
ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate (PubChem CID 21038454) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate.
| Compound Name | ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 21038454 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)NCCC(=O)OCC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H43NO5/c1-3-5-6-10-21(28)12-13-22-23-17-19(16-20(23)18-24(22)29)9-7-8-11-25(30)27-15-14-26(31)32-4-2/h12-13,16,20-24,28-29H,3-11,14-15,17-18H2,1-2H3,(H,27,30)/b13-12+/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | ZYGKWVWQIGTPFI-QJWSUBFZSA-N |
| XLogP | 4.06 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|