C27H45NO5 — CID 21038455
ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate (PubChem CID 21038455) has the molecular formula C27H45NO5 and a molecular weight of 463.66 g/mol. Its IUPAC name is ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate.
| Compound Name | ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 21038455 |
| Molecular Formula | C27H45NO5 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | ethyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)NCCC(=O)OCC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H45NO5/c1-4-6-14-27(3,32)15-9-11-22-23-18-20(17-21(23)19-24(22)29)10-7-8-12-25(30)28-16-13-26(31)33-5-2/h9,11,17,21-24,29,32H,4-8,10,12-16,18-19H2,1-3H3,(H,28,30)/b11-9+/t21-,22+,23-,24+,27-/m0/s1 |
| InChIKey | RTLOLGGCCWURDP-RXMVTXHQSA-N |
| XLogP | 4.45 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|