C24H41NO4 — CID 21038459
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(2-hydroxyethyl)pentanamide (PubChem CID 21038459) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(2-hydroxyethyl)pentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(2-hydroxyethyl)pentanamide |
|---|---|
| PubChem CID | 21038459 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(2-hydroxyethyl)pentanamide |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)NCCO)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H41NO4/c1-3-4-11-24(2,29)12-7-9-20-21-16-18(15-19(21)17-22(20)27)8-5-6-10-23(28)25-13-14-26/h7,9,15,19-22,26-27,29H,3-6,8,10-14,16-17H2,1-2H3,(H,25,28)/b9-7+/t19-,20+,21-,22+,24-/m0/s1 |
| InChIKey | OYBPQBAQXJUGPK-XQESENSJSA-N |
| XLogP | 3.49 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|