C25H39NO5 — CID 21038465
methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate (PubChem CID 21038465) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate.
| Compound Name | methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 21038465 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C25H39NO5/c1-31-25(30)12-13-26-24(29)9-5-2-6-17-14-19-16-23(28)20(21(19)15-17)10-11-22(27)18-7-3-4-8-18/h10-11,14,18-23,27-28H,2-9,12-13,15-16H2,1H3,(H,26,29)/b11-10+/t19-,20+,21-,22+,23+/m0/s1 |
| InChIKey | JDKUIGMXZXEXEV-PKQWKRQISA-N |
| XLogP | 3.28 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|