C26H41NO5 — CID 21038466
methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate (PubChem CID 21038466) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate.
| Compound Name | methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
|---|---|
| PubChem CID | 21038466 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | methyl 3-[5-[(3aS,5R,6R,6aS)-6-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@@H](O)CC3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C26H41NO5/c1-32-26(31)12-13-27-25(30)9-5-4-8-19-14-20-17-24(29)22(23(20)16-19)11-10-21(28)15-18-6-2-3-7-18/h10-11,14,18,20-24,28-29H,2-9,12-13,15-17H2,1H3,(H,27,30)/b11-10+/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | HHPBOBWJAVRPKE-UGRAUTIKSA-N |
| XLogP | 3.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|