C25H43NO3 — CID 21038527
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide (PubChem CID 21038527) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 21038527 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)N(CC)CC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO3/c1-4-7-8-12-21(27)14-15-22-23-17-19(16-20(23)18-24(22)28)11-9-10-13-25(29)26(5-2)6-3/h14-16,20-24,27-28H,4-13,17-18H2,1-3H3/b15-14+/t20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | ZBBIQJSFNAFOCZ-ABAZFCIASA-N |
| XLogP | 4.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|