C23H39NO2 — CID 21038564
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 21038564) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 21038564 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CCCCCC/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H39NO2/c1-4-5-6-7-8-9-13-20-21-16-18(15-19(21)17-22(20)25)12-10-11-14-23(26)24(2)3/h9,13,15,19-22,25H,4-8,10-12,14,16-17H2,1-3H3/b13-9+/t19-,20+,21-,22+/m0/s1 |
| InChIKey | UJIJALXXOUIDBD-RXDMUJMVSA-N |
| XLogP | 5.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|