C24H41NO2 — CID 21038608
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide (PubChem CID 21038608) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 21038608 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dimethylpentanamide |
| SMILES | CCCC[C@H](C)C/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)N(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H41NO2/c1-5-6-10-18(2)11-9-13-21-22-16-19(15-20(22)17-23(21)26)12-7-8-14-24(27)25(3)4/h9,13,15,18,20-23,26H,5-8,10-12,14,16-17H2,1-4H3/b13-9+/t18-,20-,21+,22-,23+/m0/s1 |
| InChIKey | PJIQAMSZPSBUKN-AXVUNVLCSA-N |
| XLogP | 5.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|